About ethyl 4-(3-aminophenyl)-3-(1,3-thiazol-2-yl)piperidine-4-carboxylate
ethyl 4-(3-aminophenyl)-3-(1,3-thiazol-2-yl)piperidine-4-carboxylate (PubChem CID 67236646) has the molecular formula C17H21N3O2S
and a molecular weight of 331.44 g/mol. Its IUPAC name is ethyl 4-(3-aminophenyl)-3-(1,3-thiazol-2-yl)piperidine-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-(3-aminophenyl)-3-(1,3-thiazol-2-yl)piperidine-4-carboxylate |
| PubChem CID | 67236646 |
| Molecular Formula | C17H21N3O2S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | ethyl 4-(3-aminophenyl)-3-(1,3-thiazol-2-yl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1(c2cccc(N)c2)CCNCC1c1nccs1 |
| InChI | InChI=1S/C17H21N3O2S/c1-2-22-16(21)17(12-4-3-5-13(18)10-12)6-7-19-11-14(17)15-20-8-9-23-15/h3-5,8-10,14,19H,2,6-7,11,18H2,1H3 |
| InChIKey | LVTUPFKBLQWSSS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-(3-aminophenyl)-3-(1,3-thiazol-2-yl)piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(3-aminophenyl)-3-(1,3-thiazol-2-yl)piperidine-4-carboxylate?
The IUPAC name of ethyl 4-(3-aminophenyl)-3-(1,3-thiazol-2-yl)piperidine-4-carboxylate (CID 67236646) is ethyl 4-(3-aminophenyl)-3-(1,3-thiazol-2-yl)piperidine-4-carboxylate.
What is the SMILES notation for ethyl 4-(3-aminophenyl)-3-(1,3-thiazol-2-yl)piperidine-4-carboxylate?
The canonical SMILES for ethyl 4-(3-aminophenyl)-3-(1,3-thiazol-2-yl)piperidine-4-carboxylate is CCOC(=O)C1(c2cccc(N)c2)CCNCC1c1nccs1.
What is the InChIKey of ethyl 4-(3-aminophenyl)-3-(1,3-thiazol-2-yl)piperidine-4-carboxylate?
The InChIKey is LVTUPFKBLQWSSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3O2S/c1-2-22-16(21)17(12-4-3-5-13(18)10-12)6-7-19-11-14(17)15-20-8-9-23-15/h3-5,8-10,14,19H,2,6-7,11,18H2,1H3.
What are the key properties of ethyl 4-(3-aminophenyl)-3-(1,3-thiazol-2-yl)piperidine-4-carboxylate?
ethyl 4-(3-aminophenyl)-3-(1,3-thiazol-2-yl)piperidine-4-carboxylate has a molecular weight of 331.44 g/mol, XLogP of 2.30, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(3-aminophenyl)-3-(1,3-thiazol-2-yl)piperidine-4-carboxylate is sourced from PubChem (CID 67236646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).