C28H30BFN2O4 — CID 67236660
1-(4-fluorophenyl)-2-(4-nitrophenyl)-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidine (PubChem CID 67236660) has the molecular formula C28H30BFN2O4 and a molecular weight of 488.37 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-2-(4-nitrophenyl)-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidine.
| Compound Name | 1-(4-fluorophenyl)-2-(4-nitrophenyl)-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidine |
|---|---|
| PubChem CID | 67236660 |
| Molecular Formula | C28H30BFN2O4 |
| Molecular Weight | 488.37 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | 1-(4-fluorophenyl)-2-(4-nitrophenyl)-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidine |
| SMILES | CC1(C)OB(c2ccc(C3CCC(c4ccc([N+](=O)[O-])cc4)N3c3ccc(F)cc3)cc2)OC1(C)C |
| InChI | InChI=1S/C28H30BFN2O4/c1-27(2)28(3,4)36-29(35-27)21-9-5-19(6-10-21)25-17-18-26(20-7-13-24(14-8-20)32(33)34)31(25)23-15-11-22(30)12-16-23/h5-16,25-26H,17-18H2,1-4H3 |
| InChIKey | ARILLDGMOPAAMR-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.37 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|