C10H14FN5O4 — CID 67236737
2-amino-2-fluoro-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,8-dihydropurin-6-one (PubChem CID 67236737) has the molecular formula C10H14FN5O4 and a molecular weight of 287.25 g/mol. Its IUPAC name is 2-amino-2-fluoro-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,8-dihydropurin-6-one.
| Compound Name | 2-amino-2-fluoro-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,8-dihydropurin-6-one |
|---|---|
| PubChem CID | 67236737 |
| Molecular Formula | C10H14FN5O4 |
| Molecular Weight | 287.25 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 2-amino-2-fluoro-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,8-dihydropurin-6-one |
| SMILES | NC1(F)N=C2C(=NCN2[C@H]2C[C@H](O)[C@@H](CO)O2)C(=O)N1 |
| InChI | InChI=1S/C10H14FN5O4/c11-10(12)14-8-7(9(19)15-10)13-3-16(8)6-1-4(18)5(2-17)20-6/h4-6,17-18H,1-3,12H2,(H,15,19)/t4-,5+,6+,10?/m0/s1 |
| InChIKey | OLJCCNQPRYKDBC-JKGXRCIZSA-N |
| XLogP | -2.76 |
| TPSA | 132.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.25 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|