C26H26BrClN2O2 — CID 67236981
2-(4-bromophenyl)-1-(4-tert-butylphenyl)-5-(4-chloro-3-nitrophenyl)pyrrolidine (PubChem CID 67236981) has the molecular formula C26H26BrClN2O2 and a molecular weight of 513.86 g/mol. Its IUPAC name is 2-(4-bromophenyl)-1-(4-tert-butylphenyl)-5-(4-chloro-3-nitrophenyl)pyrrolidine.
| Compound Name | 2-(4-bromophenyl)-1-(4-tert-butylphenyl)-5-(4-chloro-3-nitrophenyl)pyrrolidine |
|---|---|
| PubChem CID | 67236981 |
| Molecular Formula | C26H26BrClN2O2 |
| Molecular Weight | 513.86 g/mol |
| Exact Mass | 512.09 |
| IUPAC Name | 2-(4-bromophenyl)-1-(4-tert-butylphenyl)-5-(4-chloro-3-nitrophenyl)pyrrolidine |
| SMILES | CC(C)(C)c1ccc(N2C(c3ccc(Br)cc3)CCC2c2ccc(Cl)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C26H26BrClN2O2/c1-26(2,3)19-7-11-21(12-8-19)29-23(17-4-9-20(27)10-5-17)14-15-24(29)18-6-13-22(28)25(16-18)30(31)32/h4-13,16,23-24H,14-15H2,1-3H3 |
| InChIKey | IYZMTUNBSLJPAV-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.86 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|