C15H17N3O3 — CID 67237184
ethyl (12S,13S)-12,13-dimethyl-10-oxo-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene-4-carboxylate (PubChem CID 67237184) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is ethyl (12S,13S)-12,13-dimethyl-10-oxo-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene-4-carboxylate.
| Compound Name | ethyl (12S,13S)-12,13-dimethyl-10-oxo-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene-4-carboxylate |
|---|---|
| PubChem CID | 67237184 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | ethyl (12S,13S)-12,13-dimethyl-10-oxo-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene-4-carboxylate |
| SMILES | CCOC(=O)c1ccc2cc3n(c2n1)[C@@H](C)[C@H](C)NC3=O |
| InChI | InChI=1S/C15H17N3O3/c1-4-21-15(20)11-6-5-10-7-12-14(19)16-8(2)9(3)18(12)13(10)17-11/h5-9H,4H2,1-3H3,(H,16,19)/t8-,9-/m0/s1 |
| InChIKey | QOPHIEMRXKVJBI-IUCAKERBSA-N |
| XLogP | 1.91 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |