C21H21N3 — CID 67237630
(1R,12S)-7-[2-(6-methyl-3-pyridinyl)ethenyl]-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3,5,7-tetraene (PubChem CID 67237630) has the molecular formula C21H21N3 and a molecular weight of 315.42 g/mol. Its IUPAC name is (1R,12S)-7-[2-(6-methyl-3-pyridinyl)ethenyl]-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3,5,7-tetraene.
| Compound Name | (1R,12S)-7-[2-(6-methyl-3-pyridinyl)ethenyl]-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3,5,7-tetraene |
|---|---|
| PubChem CID | 67237630 |
| Molecular Formula | C21H21N3 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | (1R,12S)-7-[2-(6-methyl-3-pyridinyl)ethenyl]-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3,5,7-tetraene |
| SMILES | Cc1ccc(C=Cc2cccc3c4c([nH]c23)C[C@@H]2CC[C@H]4N2)cn1 |
| InChI | InChI=1S/C21H21N3/c1-13-5-6-14(12-22-13)7-8-15-3-2-4-17-20-18-10-9-16(23-18)11-19(20)24-21(15)17/h2-8,12,16,18,23-24H,9-11H2,1H3/t16-,18+/m0/s1 |
| InChIKey | ZEPWIECWKQULPS-FUHWJXTLSA-N |
| XLogP | 4.39 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|