C20H20Cl2N4O2S — CID 67238352
N'-[2-chloro-4-[[3-[(2-chlorophenoxy)methyl]-1,2,4-thiadiazol-5-yl]oxy]-5-methylphenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 67238352) has the molecular formula C20H20Cl2N4O2S and a molecular weight of 451.38 g/mol. Its IUPAC name is N'-[2-chloro-4-[[3-[(2-chlorophenoxy)methyl]-1,2,4-thiadiazol-5-yl]oxy]-5-methylphenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[2-chloro-4-[[3-[(2-chlorophenoxy)methyl]-1,2,4-thiadiazol-5-yl]oxy]-5-methylphenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 67238352 |
| Molecular Formula | C20H20Cl2N4O2S |
| Molecular Weight | 451.38 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | N'-[2-chloro-4-[[3-[(2-chlorophenoxy)methyl]-1,2,4-thiadiazol-5-yl]oxy]-5-methylphenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(Oc2nc(COc3ccccc3Cl)ns2)cc1Cl |
| InChI | InChI=1S/C20H20Cl2N4O2S/c1-4-26(3)12-23-16-9-13(2)18(10-15(16)22)28-20-24-19(25-29-20)11-27-17-8-6-5-7-14(17)21/h5-10,12H,4,11H2,1-3H3/b23-12+ |
| InChIKey | IHKRYYLTAIFRNJ-FSJBWODESA-N |
| XLogP | 6.14 |
| TPSA | 59.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.38 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|