C22H23N3 — CID 67238839
5-[2-(6-methyl-3-pyridinyl)ethenyl]-3,12-diazatetracyclo[10.2.2.02,10.04,9]hexadeca-2(10),4,6,8-tetraene (PubChem CID 67238839) has the molecular formula C22H23N3 and a molecular weight of 329.45 g/mol. Its IUPAC name is 5-[2-(6-methyl-3-pyridinyl)ethenyl]-3,12-diazatetracyclo[10.2.2.02,10.04,9]hexadeca-2(10),4,6,8-tetraene.
| Compound Name | 5-[2-(6-methyl-3-pyridinyl)ethenyl]-3,12-diazatetracyclo[10.2.2.02,10.04,9]hexadeca-2(10),4,6,8-tetraene |
|---|---|
| PubChem CID | 67238839 |
| Molecular Formula | C22H23N3 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 5-[2-(6-methyl-3-pyridinyl)ethenyl]-3,12-diazatetracyclo[10.2.2.02,10.04,9]hexadeca-2(10),4,6,8-tetraene |
| SMILES | Cc1ccc(C=Cc2cccc3c4c([nH]c23)C2CCN(CC2)C4)cn1 |
| InChI | InChI=1S/C22H23N3/c1-15-5-6-16(13-23-15)7-8-17-3-2-4-19-20-14-25-11-9-18(10-12-25)22(20)24-21(17)19/h2-8,13,18,24H,9-12,14H2,1H3 |
| InChIKey | DKODVFSNFVFHFK-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |