C22H18ClFO5S — CID 67239082
methyl (2S)-2-[2-[4-(benzenesulfonyl)-3-chlorophenyl]-4-fluorophenoxy]propanoate (PubChem CID 67239082) has the molecular formula C22H18ClFO5S and a molecular weight of 448.90 g/mol. Its IUPAC name is methyl (2S)-2-[2-[4-(benzenesulfonyl)-3-chlorophenyl]-4-fluorophenoxy]propanoate.
| Compound Name | methyl (2S)-2-[2-[4-(benzenesulfonyl)-3-chlorophenyl]-4-fluorophenoxy]propanoate |
|---|---|
| PubChem CID | 67239082 |
| Molecular Formula | C22H18ClFO5S |
| Molecular Weight | 448.90 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | methyl (2S)-2-[2-[4-(benzenesulfonyl)-3-chlorophenyl]-4-fluorophenoxy]propanoate |
| SMILES | COC(=O)[C@H](C)Oc1ccc(F)cc1-c1ccc(S(=O)(=O)c2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C22H18ClFO5S/c1-14(22(25)28-2)29-20-10-9-16(24)13-18(20)15-8-11-21(19(23)12-15)30(26,27)17-6-4-3-5-7-17/h3-14H,1-2H3/t14-/m0/s1 |
| InChIKey | FURGOGVNMQFUAJ-AWEZNQCLSA-N |
| XLogP | 4.92 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.90 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |