C30H25F3N6O3 — CID 67239144
[amino-[4-[5-(3-imidazol-1-ylpropylcarbamoyl)-3-phenyl-1,6-naphthyridin-2-yl]phenyl]methyl] 2,2,2-trifluoroacetate (PubChem CID 67239144) has the molecular formula C30H25F3N6O3 and a molecular weight of 574.56 g/mol. Its IUPAC name is [amino-[4-[5-(3-imidazol-1-ylpropylcarbamoyl)-3-phenyl-1,6-naphthyridin-2-yl]phenyl]methyl] 2,2,2-trifluoroacetate.
| Compound Name | [amino-[4-[5-(3-imidazol-1-ylpropylcarbamoyl)-3-phenyl-1,6-naphthyridin-2-yl]phenyl]methyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 67239144 |
| Molecular Formula | C30H25F3N6O3 |
| Molecular Weight | 574.56 g/mol |
| Exact Mass | 574.19 |
| IUPAC Name | [amino-[4-[5-(3-imidazol-1-ylpropylcarbamoyl)-3-phenyl-1,6-naphthyridin-2-yl]phenyl]methyl] 2,2,2-trifluoroacetate |
| SMILES | NC(OC(=O)C(F)(F)F)c1ccc(-c2nc3ccnc(C(=O)NCCCn4ccnc4)c3cc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C30H25F3N6O3/c31-30(32,33)29(41)42-27(34)21-9-7-20(8-10-21)25-22(19-5-2-1-3-6-19)17-23-24(38-25)11-13-36-26(23)28(40)37-12-4-15-39-16-14-35-18-39/h1-3,5-11,13-14,16-18,27H,4,12,15,34H2,(H,37,40) |
| InChIKey | FWHPWURDIPUMCG-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 125.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.56 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|