C14H15N3O3 — CID 67239191
ethyl 13-methyl-10-oxo-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene-4-carboxylate (PubChem CID 67239191) has the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. Its IUPAC name is ethyl 13-methyl-10-oxo-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene-4-carboxylate.
| Compound Name | ethyl 13-methyl-10-oxo-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene-4-carboxylate |
|---|---|
| PubChem CID | 67239191 |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | ethyl 13-methyl-10-oxo-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene-4-carboxylate |
| SMILES | CCOC(=O)c1ccc2cc3n(c2n1)C(C)CNC3=O |
| InChI | InChI=1S/C14H15N3O3/c1-3-20-14(19)10-5-4-9-6-11-13(18)15-7-8(2)17(11)12(9)16-10/h4-6,8H,3,7H2,1-2H3,(H,15,18) |
| InChIKey | CXCFJXWZSCPZLW-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |