C24H22N6O3S — CID 67239381
3-[2-[3-(hydroxymethyl)-4-methylpiperazin-1-yl]quinazolin-4-yl]-4-(4H-thieno[3,2-b]pyrrol-6-yl)pyrrole-2,5-dione (PubChem CID 67239381) has the molecular formula C24H22N6O3S and a molecular weight of 474.55 g/mol. Its IUPAC name is 3-[2-[3-(hydroxymethyl)-4-methylpiperazin-1-yl]quinazolin-4-yl]-4-(4H-thieno[3,2-b]pyrrol-6-yl)pyrrole-2,5-dione.
| Compound Name | 3-[2-[3-(hydroxymethyl)-4-methylpiperazin-1-yl]quinazolin-4-yl]-4-(4H-thieno[3,2-b]pyrrol-6-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 67239381 |
| Molecular Formula | C24H22N6O3S |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 3-[2-[3-(hydroxymethyl)-4-methylpiperazin-1-yl]quinazolin-4-yl]-4-(4H-thieno[3,2-b]pyrrol-6-yl)pyrrole-2,5-dione |
| SMILES | CN1CCN(c2nc(C3=C(c4c[nH]c5ccsc45)C(=O)NC3=O)c3ccccc3n2)CC1CO |
| InChI | InChI=1S/C24H22N6O3S/c1-29-7-8-30(11-13(29)12-31)24-26-16-5-3-2-4-14(16)20(27-24)19-18(22(32)28-23(19)33)15-10-25-17-6-9-34-21(15)17/h2-6,9-10,13,25,31H,7-8,11-12H2,1H3,(H,28,32,33) |
| InChIKey | MHPCWFLDJZCYGE-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 114.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|