About 4-methyl-N-(4-morpholin-2-ylphenyl)-2-pyrazin-2-yl-1,3-thiazole-5-carboxamide
4-methyl-N-(4-morpholin-2-ylphenyl)-2-pyrazin-2-yl-1,3-thiazole-5-carboxamide (PubChem CID 67239407) has the molecular formula C19H19N5O2S
and a molecular weight of 381.46 g/mol. Its IUPAC name is 4-methyl-N-(4-morpholin-2-ylphenyl)-2-pyrazin-2-yl-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | 4-methyl-N-(4-morpholin-2-ylphenyl)-2-pyrazin-2-yl-1,3-thiazole-5-carboxamide |
| PubChem CID | 67239407 |
| Molecular Formula | C19H19N5O2S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 4-methyl-N-(4-morpholin-2-ylphenyl)-2-pyrazin-2-yl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(-c2cnccn2)sc1C(=O)Nc1ccc(C2CNCCO2)cc1 |
| InChI | InChI=1S/C19H19N5O2S/c1-12-17(27-19(23-12)15-10-20-6-7-22-15)18(25)24-14-4-2-13(3-5-14)16-11-21-8-9-26-16/h2-7,10,16,21H,8-9,11H2,1H3,(H,24,25) |
| InChIKey | RWYDLOSLSOYPTC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-methyl-N-(4-morpholin-2-ylphenyl)-2-pyrazin-2-yl-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-N-(4-morpholin-2-ylphenyl)-2-pyrazin-2-yl-1,3-thiazole-5-carboxamide?
The IUPAC name of 4-methyl-N-(4-morpholin-2-ylphenyl)-2-pyrazin-2-yl-1,3-thiazole-5-carboxamide (CID 67239407) is 4-methyl-N-(4-morpholin-2-ylphenyl)-2-pyrazin-2-yl-1,3-thiazole-5-carboxamide.
What is the SMILES notation for 4-methyl-N-(4-morpholin-2-ylphenyl)-2-pyrazin-2-yl-1,3-thiazole-5-carboxamide?
The canonical SMILES for 4-methyl-N-(4-morpholin-2-ylphenyl)-2-pyrazin-2-yl-1,3-thiazole-5-carboxamide is Cc1nc(-c2cnccn2)sc1C(=O)Nc1ccc(C2CNCCO2)cc1.
What is the InChIKey of 4-methyl-N-(4-morpholin-2-ylphenyl)-2-pyrazin-2-yl-1,3-thiazole-5-carboxamide?
The InChIKey is RWYDLOSLSOYPTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N5O2S/c1-12-17(27-19(23-12)15-10-20-6-7-22-15)18(25)24-14-4-2-13(3-5-14)16-11-21-8-9-26-16/h2-7,10,16,21H,8-9,11H2,1H3,(H,24,25).
What are the key properties of 4-methyl-N-(4-morpholin-2-ylphenyl)-2-pyrazin-2-yl-1,3-thiazole-5-carboxamide?
4-methyl-N-(4-morpholin-2-ylphenyl)-2-pyrazin-2-yl-1,3-thiazole-5-carboxamide has a molecular weight of 381.46 g/mol, XLogP of 2.82, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-N-(4-morpholin-2-ylphenyl)-2-pyrazin-2-yl-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 67239407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).