C27H28N4O3S — CID 67239503
3-[1-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]indol-3-yl]-4-(4H-thieno[3,2-b]pyrrol-6-yl)pyrrole-2,5-dione (PubChem CID 67239503) has the molecular formula C27H28N4O3S and a molecular weight of 488.61 g/mol. Its IUPAC name is 3-[1-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]indol-3-yl]-4-(4H-thieno[3,2-b]pyrrol-6-yl)pyrrole-2,5-dione.
| Compound Name | 3-[1-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]indol-3-yl]-4-(4H-thieno[3,2-b]pyrrol-6-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 67239503 |
| Molecular Formula | C27H28N4O3S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | 3-[1-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]indol-3-yl]-4-(4H-thieno[3,2-b]pyrrol-6-yl)pyrrole-2,5-dione |
| SMILES | COCCN1CCC(Cn2cc(C3=C(c4c[nH]c5ccsc45)C(=O)NC3=O)c3ccccc32)CC1 |
| InChI | InChI=1S/C27H28N4O3S/c1-34-12-11-30-9-6-17(7-10-30)15-31-16-20(18-4-2-3-5-22(18)31)24-23(26(32)29-27(24)33)19-14-28-21-8-13-35-25(19)21/h2-5,8,13-14,16-17,28H,6-7,9-12,15H2,1H3,(H,29,32,33) |
| InChIKey | KTMZEFOIQOJSDT-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 79.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|