About 3-(2-prop-2-enyl-4,5-dihydroimidazol-1-yl)prop-1-en-1-amine
3-(2-prop-2-enyl-4,5-dihydroimidazol-1-yl)prop-1-en-1-amine (PubChem CID 67239727) has the molecular formula C9H15N3
and a molecular weight of 165.24 g/mol. Its IUPAC name is 3-(2-prop-2-enyl-4,5-dihydroimidazol-1-yl)prop-1-en-1-amine.
Molecular Properties
| Compound Name | 3-(2-prop-2-enyl-4,5-dihydroimidazol-1-yl)prop-1-en-1-amine |
| PubChem CID | 67239727 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 3-(2-prop-2-enyl-4,5-dihydroimidazol-1-yl)prop-1-en-1-amine |
| SMILES | C=CCC1=NCCN1CC=CN |
| InChI | InChI=1S/C9H15N3/c1-2-4-9-11-6-8-12(9)7-3-5-10/h2-3,5H,1,4,6-8,10H2 |
| InChIKey | FQTLIPUPUFMWNS-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-prop-2-enyl-4,5-dihydroimidazol-1-yl)prop-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-prop-2-enyl-4,5-dihydroimidazol-1-yl)prop-1-en-1-amine?
The IUPAC name of 3-(2-prop-2-enyl-4,5-dihydroimidazol-1-yl)prop-1-en-1-amine (CID 67239727) is 3-(2-prop-2-enyl-4,5-dihydroimidazol-1-yl)prop-1-en-1-amine.
What is the SMILES notation for 3-(2-prop-2-enyl-4,5-dihydroimidazol-1-yl)prop-1-en-1-amine?
The canonical SMILES for 3-(2-prop-2-enyl-4,5-dihydroimidazol-1-yl)prop-1-en-1-amine is C=CCC1=NCCN1CC=CN.
What is the InChIKey of 3-(2-prop-2-enyl-4,5-dihydroimidazol-1-yl)prop-1-en-1-amine?
The InChIKey is FQTLIPUPUFMWNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3/c1-2-4-9-11-6-8-12(9)7-3-5-10/h2-3,5H,1,4,6-8,10H2.
What are the key properties of 3-(2-prop-2-enyl-4,5-dihydroimidazol-1-yl)prop-1-en-1-amine?
3-(2-prop-2-enyl-4,5-dihydroimidazol-1-yl)prop-1-en-1-amine has a molecular weight of 165.24 g/mol, XLogP of 0.75, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-prop-2-enyl-4,5-dihydroimidazol-1-yl)prop-1-en-1-amine is sourced from PubChem (CID 67239727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).