C30H40BN3O6 — CID 67239816
tert-butyl N-[(1R)-2-oxo-1-phenyl-2-[(2S)-2-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamoyl]pyrrolidin-1-yl]ethyl]carbamate (PubChem CID 67239816) has the molecular formula C30H40BN3O6 and a molecular weight of 549.48 g/mol. Its IUPAC name is tert-butyl N-[(1R)-2-oxo-1-phenyl-2-[(2S)-2-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamoyl]pyrrolidin-1-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-2-oxo-1-phenyl-2-[(2S)-2-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamoyl]pyrrolidin-1-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 67239816 |
| Molecular Formula | C30H40BN3O6 |
| Molecular Weight | 549.48 g/mol |
| Exact Mass | 549.30 |
| IUPAC Name | tert-butyl N-[(1R)-2-oxo-1-phenyl-2-[(2S)-2-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamoyl]pyrrolidin-1-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C(=O)N1CCC[C@H]1C(=O)Nc1cccc(B2OC(C)(C)C(C)(C)O2)c1)c1ccccc1 |
| InChI | InChI=1S/C30H40BN3O6/c1-28(2,3)38-27(37)33-24(20-13-9-8-10-14-20)26(36)34-18-12-17-23(34)25(35)32-22-16-11-15-21(19-22)31-39-29(4,5)30(6,7)40-31/h8-11,13-16,19,23-24H,12,17-18H2,1-7H3,(H,32,35)(H,33,37)/t23-,24+/m0/s1 |
| InChIKey | SPMYWDJXYMICSW-BJKOFHAPSA-N |
| XLogP | 4.18 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.48 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|