C25H23FN6O2S — CID 67240016
3-[2-(4-amino-4-ethyl-3-fluoropiperidin-1-yl)quinazolin-4-yl]-4-(4H-thieno[3,2-b]pyrrol-6-yl)pyrrole-2,5-dione (PubChem CID 67240016) has the molecular formula C25H23FN6O2S and a molecular weight of 490.56 g/mol. Its IUPAC name is 3-[2-(4-amino-4-ethyl-3-fluoropiperidin-1-yl)quinazolin-4-yl]-4-(4H-thieno[3,2-b]pyrrol-6-yl)pyrrole-2,5-dione.
| Compound Name | 3-[2-(4-amino-4-ethyl-3-fluoropiperidin-1-yl)quinazolin-4-yl]-4-(4H-thieno[3,2-b]pyrrol-6-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 67240016 |
| Molecular Formula | C25H23FN6O2S |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | 3-[2-(4-amino-4-ethyl-3-fluoropiperidin-1-yl)quinazolin-4-yl]-4-(4H-thieno[3,2-b]pyrrol-6-yl)pyrrole-2,5-dione |
| SMILES | CCC1(N)CCN(c2nc(C3=C(c4c[nH]c5ccsc45)C(=O)NC3=O)c3ccccc3n2)CC1F |
| InChI | InChI=1S/C25H23FN6O2S/c1-2-25(27)8-9-32(12-17(25)26)24-29-15-6-4-3-5-13(15)20(30-24)19-18(22(33)31-23(19)34)14-11-28-16-7-10-35-21(14)16/h3-7,10-11,17,28H,2,8-9,12,27H2,1H3,(H,31,33,34) |
| InChIKey | WQYZPJBILZFEPY-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|