C29H36N4O4S — CID 67240025
[5-[(4-butylphenyl)sulfamoylamino]-2-methylphenyl]-[2-(2-methoxyphenyl)piperazin-1-yl]methanone (PubChem CID 67240025) has the molecular formula C29H36N4O4S and a molecular weight of 536.70 g/mol. Its IUPAC name is [5-[(4-butylphenyl)sulfamoylamino]-2-methylphenyl]-[2-(2-methoxyphenyl)piperazin-1-yl]methanone.
| Compound Name | [5-[(4-butylphenyl)sulfamoylamino]-2-methylphenyl]-[2-(2-methoxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 67240025 |
| Molecular Formula | C29H36N4O4S |
| Molecular Weight | 536.70 g/mol |
| Exact Mass | 536.25 |
| IUPAC Name | [5-[(4-butylphenyl)sulfamoylamino]-2-methylphenyl]-[2-(2-methoxyphenyl)piperazin-1-yl]methanone |
| SMILES | CCCCc1ccc(NS(=O)(=O)Nc2ccc(C)c(C(=O)N3CCNCC3c3ccccc3OC)c2)cc1 |
| InChI | InChI=1S/C29H36N4O4S/c1-4-5-8-22-12-15-23(16-13-22)31-38(35,36)32-24-14-11-21(2)26(19-24)29(34)33-18-17-30-20-27(33)25-9-6-7-10-28(25)37-3/h6-7,9-16,19,27,30-32H,4-5,8,17-18,20H2,1-3H3 |
| InChIKey | JZIWGEGPVQTQKG-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.70 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_E(2)', 'substructure': 'N/A'} |
|---|