About N-(difluoromethyl)-1,3-thiazole-5-carboxamide
N-(difluoromethyl)-1,3-thiazole-5-carboxamide (PubChem CID 67240228) has the molecular formula C5H4F2N2OS
and a molecular weight of 178.16 g/mol. Its IUPAC name is N-(difluoromethyl)-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | N-(difluoromethyl)-1,3-thiazole-5-carboxamide |
| PubChem CID | 67240228 |
| Molecular Formula | C5H4F2N2OS |
| Molecular Weight | 178.16 g/mol |
| Exact Mass | 178.00 |
| IUPAC Name | N-(difluoromethyl)-1,3-thiazole-5-carboxamide |
| SMILES | O=C(NC(F)F)c1cncs1 |
| InChI | InChI=1S/C5H4F2N2OS/c6-5(7)9-4(10)3-1-8-2-11-3/h1-2,5H,(H,9,10) |
| InChIKey | SOVABSPIMVGCIX-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.16 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-(difluoromethyl)-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(difluoromethyl)-1,3-thiazole-5-carboxamide?
The IUPAC name of N-(difluoromethyl)-1,3-thiazole-5-carboxamide (CID 67240228) is N-(difluoromethyl)-1,3-thiazole-5-carboxamide.
What is the SMILES notation for N-(difluoromethyl)-1,3-thiazole-5-carboxamide?
The canonical SMILES for N-(difluoromethyl)-1,3-thiazole-5-carboxamide is O=C(NC(F)F)c1cncs1.
What is the InChIKey of N-(difluoromethyl)-1,3-thiazole-5-carboxamide?
The InChIKey is SOVABSPIMVGCIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4F2N2OS/c6-5(7)9-4(10)3-1-8-2-11-3/h1-2,5H,(H,9,10).
What are the key properties of N-(difluoromethyl)-1,3-thiazole-5-carboxamide?
N-(difluoromethyl)-1,3-thiazole-5-carboxamide has a molecular weight of 178.16 g/mol, XLogP of 1.10, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(difluoromethyl)-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 67240228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).