C20H25Cl2N3O — CID 67240233
1-(4-chlorophenyl)-3-[4-(2-piperidin-3-ylethyl)phenyl]urea;hydrochloride (PubChem CID 67240233) has the molecular formula C20H25Cl2N3O and a molecular weight of 394.35 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[4-(2-piperidin-3-ylethyl)phenyl]urea;hydrochloride.
| Compound Name | 1-(4-chlorophenyl)-3-[4-(2-piperidin-3-ylethyl)phenyl]urea;hydrochloride |
|---|---|
| PubChem CID | 67240233 |
| Molecular Formula | C20H25Cl2N3O |
| Molecular Weight | 394.35 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[4-(2-piperidin-3-ylethyl)phenyl]urea;hydrochloride |
| SMILES | Cl.O=C(Nc1ccc(Cl)cc1)Nc1ccc(CCC2CCCNC2)cc1 |
| InChI | InChI=1S/C20H24ClN3O.ClH/c21-17-7-11-19(12-8-17)24-20(25)23-18-9-5-15(6-10-18)3-4-16-2-1-13-22-14-16;/h5-12,16,22H,1-4,13-14H2,(H2,23,24,25);1H |
| InChIKey | XRWZQVBZGIBBOU-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.35 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |