C30H30N4O4 — CID 67240337
N-[4-[2-[(4,6-dimethyl-2-pyridinyl)oxy]ethylamino]phenyl]-2-oxo-2-(7-phenyl-3,4-dihydro-1H-pyrrolo[2,1-c][1,4]oxazin-6-yl)acetamide (PubChem CID 67240337) has the molecular formula C30H30N4O4 and a molecular weight of 510.59 g/mol. Its IUPAC name is N-[4-[2-[(4,6-dimethyl-2-pyridinyl)oxy]ethylamino]phenyl]-2-oxo-2-(7-phenyl-3,4-dihydro-1H-pyrrolo[2,1-c][1,4]oxazin-6-yl)acetamide.
| Compound Name | N-[4-[2-[(4,6-dimethyl-2-pyridinyl)oxy]ethylamino]phenyl]-2-oxo-2-(7-phenyl-3,4-dihydro-1H-pyrrolo[2,1-c][1,4]oxazin-6-yl)acetamide |
|---|---|
| PubChem CID | 67240337 |
| Molecular Formula | C30H30N4O4 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | N-[4-[2-[(4,6-dimethyl-2-pyridinyl)oxy]ethylamino]phenyl]-2-oxo-2-(7-phenyl-3,4-dihydro-1H-pyrrolo[2,1-c][1,4]oxazin-6-yl)acetamide |
| SMILES | Cc1cc(C)nc(OCCNc2ccc(NC(=O)C(=O)c3c(-c4ccccc4)cc4n3CCOC4)cc2)c1 |
| InChI | InChI=1S/C30H30N4O4/c1-20-16-21(2)32-27(17-20)38-14-12-31-23-8-10-24(11-9-23)33-30(36)29(35)28-26(22-6-4-3-5-7-22)18-25-19-37-15-13-34(25)28/h3-11,16-18,31H,12-15,19H2,1-2H3,(H,33,36) |
| InChIKey | NRNOIHITWJESHQ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|