C24H24N4O2S — CID 67240694
3-[1-[4-(dimethylamino)butyl]indol-3-yl]-4-(6H-thieno[2,3-b]pyrrol-4-yl)pyrrole-2,5-dione (PubChem CID 67240694) has the molecular formula C24H24N4O2S and a molecular weight of 432.55 g/mol. Its IUPAC name is 3-[1-[4-(dimethylamino)butyl]indol-3-yl]-4-(6H-thieno[2,3-b]pyrrol-4-yl)pyrrole-2,5-dione.
| Compound Name | 3-[1-[4-(dimethylamino)butyl]indol-3-yl]-4-(6H-thieno[2,3-b]pyrrol-4-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 67240694 |
| Molecular Formula | C24H24N4O2S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 3-[1-[4-(dimethylamino)butyl]indol-3-yl]-4-(6H-thieno[2,3-b]pyrrol-4-yl)pyrrole-2,5-dione |
| SMILES | CN(C)CCCCn1cc(C2=C(c3c[nH]c4sccc34)C(=O)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C24H24N4O2S/c1-27(2)10-5-6-11-28-14-18(15-7-3-4-8-19(15)28)21-20(22(29)26-23(21)30)17-13-25-24-16(17)9-12-31-24/h3-4,7-9,12-14,25H,5-6,10-11H2,1-2H3,(H,26,29,30) |
| InChIKey | AICNGDPVHQBEIZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 70.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|