About 1-Heptadec-8-enyl-1,2,4-triazol-3-amine
1-Heptadec-8-enyl-1,2,4-triazol-3-amine (PubChem CID 67240735) has the molecular formula C19H36N4
and a molecular weight of 320.50 g/mol. Its IUPAC name is 1-heptadec-8-enyl-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 1-Heptadec-8-enyl-1,2,4-triazol-3-amine |
| PubChem CID | 67240735 |
| Molecular Formula | C19H36N4 |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.29 |
| IUPAC Name | 1-heptadec-8-enyl-1,2,4-triazol-3-amine |
| SMILES | CCCCCCCCC=CCCCCCCCN1C=NC(=N1)N |
| InChI | InChI=1S/C19H36N4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-23-18-21-19(20)22-23/h9-10,18H,2-8,11-17H2,1H3,(H2,20,22) |
| InChIKey | LNVWIXRINVCMOS-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 56.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | 281 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-Heptadec-8-enyl-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-Heptadec-8-enyl-1,2,4-triazol-3-amine?
The IUPAC name of 1-Heptadec-8-enyl-1,2,4-triazol-3-amine (CID 67240735) is 1-heptadec-8-enyl-1,2,4-triazol-3-amine.
What is the SMILES notation for 1-Heptadec-8-enyl-1,2,4-triazol-3-amine?
The canonical SMILES for 1-Heptadec-8-enyl-1,2,4-triazol-3-amine is CCCCCCCCC=CCCCCCCCN1C=NC(=N1)N.
What is the InChIKey of 1-Heptadec-8-enyl-1,2,4-triazol-3-amine?
The InChIKey is LNVWIXRINVCMOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H36N4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-23-18-21-19(20)22-23/h9-10,18H,2-8,11-17H2,1H3,(H2,20,22).
What are the key properties of 1-Heptadec-8-enyl-1,2,4-triazol-3-amine?
1-Heptadec-8-enyl-1,2,4-triazol-3-amine has a molecular weight of 320.50 g/mol, XLogP of 6.90, 15 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-Heptadec-8-enyl-1,2,4-triazol-3-amine is sourced from PubChem (CID 67240735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).