About [(3R)-1,1-dimethylpyrrolidin-1-ium-3-yl] 2-(3-cyclopentyl-2-hydroxyphenyl)acetate bromide
[(3R)-1,1-dimethylpyrrolidin-1-ium-3-yl] 2-(3-cyclopentyl-2-hydroxyphenyl)acetate bromide (PubChem CID 67241606) has the molecular formula C19H28BrNO3
and a molecular weight of 398.34 g/mol. Its IUPAC name is [(3R)-1,1-dimethylpyrrolidin-1-ium-3-yl] 2-(3-cyclopentyl-2-hydroxyphenyl)acetate bromide.
Molecular Properties
| Compound Name | [(3R)-1,1-dimethylpyrrolidin-1-ium-3-yl] 2-(3-cyclopentyl-2-hydroxyphenyl)acetate bromide |
| PubChem CID | 67241606 |
| Molecular Formula | C19H28BrNO3 |
| Molecular Weight | 398.34 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | [(3R)-1,1-dimethylpyrrolidin-1-ium-3-yl] 2-(3-cyclopentyl-2-hydroxyphenyl)acetate bromide |
| SMILES | C[N+]1(C)CC[C@@H](OC(=O)Cc2cccc(C3CCCC3)c2O)C1.[Br-] |
| InChI | InChI=1S/C19H27NO3.BrH/c1-20(2)11-10-16(13-20)23-18(21)12-15-8-5-9-17(19(15)22)14-6-3-4-7-14;/h5,8-9,14,16H,3-4,6-7,10-13H2,1-2H3;1H/t16-;/m1./s1 |
| InChIKey | CBDRTUXHBXWHJC-PKLMIRHRSA-N |
| XLogP | -0.01 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.34 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [(3R)-1,1-dimethylpyrrolidin-1-ium-3-yl] 2-(3-cyclopentyl-2-hydroxyphenyl)acetate bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-1,1-dimethylpyrrolidin-1-ium-3-yl] 2-(3-cyclopentyl-2-hydroxyphenyl)acetate bromide?
The IUPAC name of [(3R)-1,1-dimethylpyrrolidin-1-ium-3-yl] 2-(3-cyclopentyl-2-hydroxyphenyl)acetate bromide (CID 67241606) is [(3R)-1,1-dimethylpyrrolidin-1-ium-3-yl] 2-(3-cyclopentyl-2-hydroxyphenyl)acetate bromide.
What is the SMILES notation for [(3R)-1,1-dimethylpyrrolidin-1-ium-3-yl] 2-(3-cyclopentyl-2-hydroxyphenyl)acetate bromide?
The canonical SMILES for [(3R)-1,1-dimethylpyrrolidin-1-ium-3-yl] 2-(3-cyclopentyl-2-hydroxyphenyl)acetate bromide is C[N+]1(C)CC[C@@H](OC(=O)Cc2cccc(C3CCCC3)c2O)C1.[Br-].
What is the InChIKey of [(3R)-1,1-dimethylpyrrolidin-1-ium-3-yl] 2-(3-cyclopentyl-2-hydroxyphenyl)acetate bromide?
The InChIKey is CBDRTUXHBXWHJC-PKLMIRHRSA-N. The full InChI is InChI=1S/C19H27NO3.BrH/c1-20(2)11-10-16(13-20)23-18(21)12-15-8-5-9-17(19(15)22)14-6-3-4-7-14;/h5,8-9,14,16H,3-4,6-7,10-13H2,1-2H3;1H/t16-;/m1./s1.
What are the key properties of [(3R)-1,1-dimethylpyrrolidin-1-ium-3-yl] 2-(3-cyclopentyl-2-hydroxyphenyl)acetate bromide?
[(3R)-1,1-dimethylpyrrolidin-1-ium-3-yl] 2-(3-cyclopentyl-2-hydroxyphenyl)acetate bromide has a molecular weight of 398.34 g/mol, XLogP of -0.01, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-1,1-dimethylpyrrolidin-1-ium-3-yl] 2-(3-cyclopentyl-2-hydroxyphenyl)acetate bromide is sourced from PubChem (CID 67241606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).