C21H22F3N3O4S — CID 67241883
2-tert-butyl-1,1-dioxo-5-phenyl-4-[2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]ethylamino]-1,2-thiazol-3-one (PubChem CID 67241883) has the molecular formula C21H22F3N3O4S and a molecular weight of 469.49 g/mol. Its IUPAC name is 2-tert-butyl-1,1-dioxo-5-phenyl-4-[2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]ethylamino]-1,2-thiazol-3-one.
| Compound Name | 2-tert-butyl-1,1-dioxo-5-phenyl-4-[2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]ethylamino]-1,2-thiazol-3-one |
|---|---|
| PubChem CID | 67241883 |
| Molecular Formula | C21H22F3N3O4S |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | 2-tert-butyl-1,1-dioxo-5-phenyl-4-[2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]ethylamino]-1,2-thiazol-3-one |
| SMILES | CC(C)(C)N1C(=O)C(NCCOc2ccc(C(F)(F)F)cn2)=C(c2ccccc2)S1(=O)=O |
| InChI | InChI=1S/C21H22F3N3O4S/c1-20(2,3)27-19(28)17(18(32(27,29)30)14-7-5-4-6-8-14)25-11-12-31-16-10-9-15(13-26-16)21(22,23)24/h4-10,13,25H,11-12H2,1-3H3 |
| InChIKey | DHLXFYAZCHQJEV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|