About 4-hydroxy-1,1-dioxo-5-phenyl-2-propan-2-yl-1,2-thiazol-3-one
4-hydroxy-1,1-dioxo-5-phenyl-2-propan-2-yl-1,2-thiazol-3-one (PubChem CID 67242125) has the molecular formula C12H13NO4S
and a molecular weight of 267.31 g/mol. Its IUPAC name is 4-hydroxy-1,1-dioxo-5-phenyl-2-propan-2-yl-1,2-thiazol-3-one.
Molecular Properties
| Compound Name | 4-hydroxy-1,1-dioxo-5-phenyl-2-propan-2-yl-1,2-thiazol-3-one |
| PubChem CID | 67242125 |
| Molecular Formula | C12H13NO4S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 4-hydroxy-1,1-dioxo-5-phenyl-2-propan-2-yl-1,2-thiazol-3-one |
| SMILES | CC(C)N1C(=O)C(O)=C(c2ccccc2)S1(=O)=O |
| InChI | InChI=1S/C12H13NO4S/c1-8(2)13-12(15)10(14)11(18(13,16)17)9-6-4-3-5-7-9/h3-8,14H,1-2H3 |
| InChIKey | QDXHLZHRDPLDBS-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-hydroxy-1,1-dioxo-5-phenyl-2-propan-2-yl-1,2-thiazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-1,1-dioxo-5-phenyl-2-propan-2-yl-1,2-thiazol-3-one?
The IUPAC name of 4-hydroxy-1,1-dioxo-5-phenyl-2-propan-2-yl-1,2-thiazol-3-one (CID 67242125) is 4-hydroxy-1,1-dioxo-5-phenyl-2-propan-2-yl-1,2-thiazol-3-one.
What is the SMILES notation for 4-hydroxy-1,1-dioxo-5-phenyl-2-propan-2-yl-1,2-thiazol-3-one?
The canonical SMILES for 4-hydroxy-1,1-dioxo-5-phenyl-2-propan-2-yl-1,2-thiazol-3-one is CC(C)N1C(=O)C(O)=C(c2ccccc2)S1(=O)=O.
What is the InChIKey of 4-hydroxy-1,1-dioxo-5-phenyl-2-propan-2-yl-1,2-thiazol-3-one?
The InChIKey is QDXHLZHRDPLDBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO4S/c1-8(2)13-12(15)10(14)11(18(13,16)17)9-6-4-3-5-7-9/h3-8,14H,1-2H3.
What are the key properties of 4-hydroxy-1,1-dioxo-5-phenyl-2-propan-2-yl-1,2-thiazol-3-one?
4-hydroxy-1,1-dioxo-5-phenyl-2-propan-2-yl-1,2-thiazol-3-one has a molecular weight of 267.31 g/mol, XLogP of 1.49, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-1,1-dioxo-5-phenyl-2-propan-2-yl-1,2-thiazol-3-one is sourced from PubChem (CID 67242125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).