C24H27FN2O6S — CID 67242364
(2R,3R,4S,5R)-7-(2-fluorophenyl)-3,4,5-trihydroxy-2-methoxy-N-[(3R)-5-methyl-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]hept-6-enamide (PubChem CID 67242364) has the molecular formula C24H27FN2O6S and a molecular weight of 490.55 g/mol. Its IUPAC name is (2R,3R,4S,5R)-7-(2-fluorophenyl)-3,4,5-trihydroxy-2-methoxy-N-[(3R)-5-methyl-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]hept-6-enamide.
| Compound Name | (2R,3R,4S,5R)-7-(2-fluorophenyl)-3,4,5-trihydroxy-2-methoxy-N-[(3R)-5-methyl-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]hept-6-enamide |
|---|---|
| PubChem CID | 67242364 |
| Molecular Formula | C24H27FN2O6S |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | (2R,3R,4S,5R)-7-(2-fluorophenyl)-3,4,5-trihydroxy-2-methoxy-N-[(3R)-5-methyl-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]hept-6-enamide |
| SMILES | CO[C@@H](C(=O)N[C@H]1CSc2ccccc2N(C)C1=O)[C@H](O)[C@@H](O)[C@H](O)C=Cc1ccccc1F |
| InChI | InChI=1S/C24H27FN2O6S/c1-27-17-9-5-6-10-19(17)34-13-16(24(27)32)26-23(31)22(33-2)21(30)20(29)18(28)12-11-14-7-3-4-8-15(14)25/h3-12,16,18,20-22,28-30H,13H2,1-2H3,(H,26,31)/t16-,18+,20-,21+,22+/m0/s1 |
| InChIKey | JUPBZRQOXBEKKT-ADZZIANESA-N |
| XLogP | 1.19 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |