C23H25FN6O2 — CID 67242801
3-[[4-[7-(4-fluorophenyl)-3-(3-hydroxypropylamino)-5H-pyrrolo[2,3-b]pyrazin-6-yl]-2-pyridinyl]amino]propan-1-ol (PubChem CID 67242801) has the molecular formula C23H25FN6O2 and a molecular weight of 436.49 g/mol. Its IUPAC name is 3-[[4-[7-(4-fluorophenyl)-3-(3-hydroxypropylamino)-5H-pyrrolo[2,3-b]pyrazin-6-yl]-2-pyridinyl]amino]propan-1-ol.
| Compound Name | 3-[[4-[7-(4-fluorophenyl)-3-(3-hydroxypropylamino)-5H-pyrrolo[2,3-b]pyrazin-6-yl]-2-pyridinyl]amino]propan-1-ol |
|---|---|
| PubChem CID | 67242801 |
| Molecular Formula | C23H25FN6O2 |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 3-[[4-[7-(4-fluorophenyl)-3-(3-hydroxypropylamino)-5H-pyrrolo[2,3-b]pyrazin-6-yl]-2-pyridinyl]amino]propan-1-ol |
| SMILES | OCCCNc1cc(-c2[nH]c3nc(NCCCO)cnc3c2-c2ccc(F)cc2)ccn1 |
| InChI | InChI=1S/C23H25FN6O2/c24-17-5-3-15(4-6-17)20-21(16-7-10-27-18(13-16)25-8-1-11-31)30-23-22(20)28-14-19(29-23)26-9-2-12-32/h3-7,10,13-14,31-32H,1-2,8-9,11-12H2,(H,25,27)(H2,26,29,30) |
| InChIKey | DMCUQDNDZRDMFZ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 118.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|