C19H24N2O3 — CID 67243320
2-[2-ethyl-1-(2-piperidin-1-ylethyl)indol-3-yl]-2-oxoacetic acid (PubChem CID 67243320) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is 2-[2-ethyl-1-(2-piperidin-1-ylethyl)indol-3-yl]-2-oxoacetic acid.
| Compound Name | 2-[2-ethyl-1-(2-piperidin-1-ylethyl)indol-3-yl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 67243320 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 2-[2-ethyl-1-(2-piperidin-1-ylethyl)indol-3-yl]-2-oxoacetic acid |
| SMILES | CCc1c(C(=O)C(=O)O)c2ccccc2n1CCN1CCCCC1 |
| InChI | InChI=1S/C19H24N2O3/c1-2-15-17(18(22)19(23)24)14-8-4-5-9-16(14)21(15)13-12-20-10-6-3-7-11-20/h4-5,8-9H,2-3,6-7,10-13H2,1H3,(H,23,24) |
| InChIKey | MXAFTOGTKSLOBL-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|