About (2S)-2-bis(phenylmethoxy)phosphoryloxy-2,3-dimethylbutanoic acid
(2S)-2-bis(phenylmethoxy)phosphoryloxy-2,3-dimethylbutanoic acid (PubChem CID 67243395) has the molecular formula C20H25O6P
and a molecular weight of 392.39 g/mol. Its IUPAC name is (2S)-2-bis(phenylmethoxy)phosphoryloxy-2,3-dimethylbutanoic acid.
Molecular Properties
| Compound Name | (2S)-2-bis(phenylmethoxy)phosphoryloxy-2,3-dimethylbutanoic acid |
| PubChem CID | 67243395 |
| Molecular Formula | C20H25O6P |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | (2S)-2-bis(phenylmethoxy)phosphoryloxy-2,3-dimethylbutanoic acid |
| SMILES | CC(C)[C@](C)(OP(=O)(OCc1ccccc1)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C20H25O6P/c1-16(2)20(3,19(21)22)26-27(23,24-14-17-10-6-4-7-11-17)25-15-18-12-8-5-9-13-18/h4-13,16H,14-15H2,1-3H3,(H,21,22)/t20-/m0/s1 |
| InChIKey | JJAWHICFHUVBCQ-FQEVSTJZSA-N |
| XLogP | 5.04 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-bis(phenylmethoxy)phosphoryloxy-2,3-dimethylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-bis(phenylmethoxy)phosphoryloxy-2,3-dimethylbutanoic acid?
The IUPAC name of (2S)-2-bis(phenylmethoxy)phosphoryloxy-2,3-dimethylbutanoic acid (CID 67243395) is (2S)-2-bis(phenylmethoxy)phosphoryloxy-2,3-dimethylbutanoic acid.
What is the SMILES notation for (2S)-2-bis(phenylmethoxy)phosphoryloxy-2,3-dimethylbutanoic acid?
The canonical SMILES for (2S)-2-bis(phenylmethoxy)phosphoryloxy-2,3-dimethylbutanoic acid is CC(C)[C@](C)(OP(=O)(OCc1ccccc1)OCc1ccccc1)C(=O)O.
What is the InChIKey of (2S)-2-bis(phenylmethoxy)phosphoryloxy-2,3-dimethylbutanoic acid?
The InChIKey is JJAWHICFHUVBCQ-FQEVSTJZSA-N. The full InChI is InChI=1S/C20H25O6P/c1-16(2)20(3,19(21)22)26-27(23,24-14-17-10-6-4-7-11-17)25-15-18-12-8-5-9-13-18/h4-13,16H,14-15H2,1-3H3,(H,21,22)/t20-/m0/s1.
What are the key properties of (2S)-2-bis(phenylmethoxy)phosphoryloxy-2,3-dimethylbutanoic acid?
(2S)-2-bis(phenylmethoxy)phosphoryloxy-2,3-dimethylbutanoic acid has a molecular weight of 392.39 g/mol, XLogP of 5.04, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-bis(phenylmethoxy)phosphoryloxy-2,3-dimethylbutanoic acid is sourced from PubChem (CID 67243395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).