About (3S)-7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3,4-dihydro-2H-chromene
(3S)-7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3,4-dihydro-2H-chromene (PubChem CID 67243467) has the molecular formula C19H22O5
and a molecular weight of 330.38 g/mol. Its IUPAC name is (3S)-7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3,4-dihydro-2H-chromene.
Molecular Properties
| Compound Name | (3S)-7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3,4-dihydro-2H-chromene |
| PubChem CID | 67243467 |
| Molecular Formula | C19H22O5 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | (3S)-7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3,4-dihydro-2H-chromene |
| SMILES | COCOc1ccc([C@H]2COc3cc(OCOC)ccc3C2)cc1 |
| InChI | InChI=1S/C19H22O5/c1-20-12-23-17-6-3-14(4-7-17)16-9-15-5-8-18(24-13-21-2)10-19(15)22-11-16/h3-8,10,16H,9,11-13H2,1-2H3/t16-/m1/s1 |
| InChIKey | XTXOTBRGNNOVBM-MRXNPFEDSA-N |
| XLogP | 3.37 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (3S)-7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3,4-dihydro-2H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3,4-dihydro-2H-chromene?
The IUPAC name of (3S)-7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3,4-dihydro-2H-chromene (CID 67243467) is (3S)-7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3,4-dihydro-2H-chromene.
What is the SMILES notation for (3S)-7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3,4-dihydro-2H-chromene?
The canonical SMILES for (3S)-7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3,4-dihydro-2H-chromene is COCOc1ccc([C@H]2COc3cc(OCOC)ccc3C2)cc1.
What is the InChIKey of (3S)-7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3,4-dihydro-2H-chromene?
The InChIKey is XTXOTBRGNNOVBM-MRXNPFEDSA-N. The full InChI is InChI=1S/C19H22O5/c1-20-12-23-17-6-3-14(4-7-17)16-9-15-5-8-18(24-13-21-2)10-19(15)22-11-16/h3-8,10,16H,9,11-13H2,1-2H3/t16-/m1/s1.
What are the key properties of (3S)-7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3,4-dihydro-2H-chromene?
(3S)-7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3,4-dihydro-2H-chromene has a molecular weight of 330.38 g/mol, XLogP of 3.37, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3,4-dihydro-2H-chromene is sourced from PubChem (CID 67243467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).