C22H28ClF3N2O6S — CID 67243528
(2R,3R,4S,5R)-N-[(3R)-9-chloro-4-oxo-7-(trifluoromethyl)-3,5-dihydro-2H-1,5-benzothiazepin-3-yl]-3,4,5-trihydroxy-2-methoxy-8,8-dimethylnon-6-enamide (PubChem CID 67243528) has the molecular formula C22H28ClF3N2O6S and a molecular weight of 540.99 g/mol. Its IUPAC name is (2R,3R,4S,5R)-N-[(3R)-9-chloro-4-oxo-7-(trifluoromethyl)-3,5-dihydro-2H-1,5-benzothiazepin-3-yl]-3,4,5-trihydroxy-2-methoxy-8,8-dimethylnon-6-enamide.
| Compound Name | (2R,3R,4S,5R)-N-[(3R)-9-chloro-4-oxo-7-(trifluoromethyl)-3,5-dihydro-2H-1,5-benzothiazepin-3-yl]-3,4,5-trihydroxy-2-methoxy-8,8-dimethylnon-6-enamide |
|---|---|
| PubChem CID | 67243528 |
| Molecular Formula | C22H28ClF3N2O6S |
| Molecular Weight | 540.99 g/mol |
| Exact Mass | 540.13 |
| IUPAC Name | (2R,3R,4S,5R)-N-[(3R)-9-chloro-4-oxo-7-(trifluoromethyl)-3,5-dihydro-2H-1,5-benzothiazepin-3-yl]-3,4,5-trihydroxy-2-methoxy-8,8-dimethylnon-6-enamide |
| SMILES | CO[C@@H](C(=O)N[C@H]1CSc2c(Cl)cc(C(F)(F)F)cc2NC1=O)[C@H](O)[C@@H](O)[C@H](O)C=CC(C)(C)C |
| InChI | InChI=1S/C22H28ClF3N2O6S/c1-21(2,3)6-5-14(29)15(30)16(31)17(34-4)20(33)28-13-9-35-18-11(23)7-10(22(24,25)26)8-12(18)27-19(13)32/h5-8,13-17,29-31H,9H2,1-4H3,(H,27,32)(H,28,33)/t13-,14+,15-,16+,17+/m0/s1 |
| InChIKey | XGHHODHXADEABY-DMRKSPOLSA-N |
| XLogP | 2.59 |
| TPSA | 128.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.99 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|