About 3-oxo-N-piperazin-1-ylspiro[2-benzofuran-1,4'-cyclohexane]-1'-carboxamide
3-oxo-N-piperazin-1-ylspiro[2-benzofuran-1,4'-cyclohexane]-1'-carboxamide (PubChem CID 67244640) has the molecular formula C18H23N3O3
and a molecular weight of 329.40 g/mol. Its IUPAC name is 3-oxo-N-piperazin-1-ylspiro[2-benzofuran-1,4'-cyclohexane]-1'-carboxamide.
Molecular Properties
| Compound Name | 3-oxo-N-piperazin-1-ylspiro[2-benzofuran-1,4'-cyclohexane]-1'-carboxamide |
| PubChem CID | 67244640 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 3-oxo-N-piperazin-1-ylspiro[2-benzofuran-1,4'-cyclohexane]-1'-carboxamide |
| SMILES | O=C1OC2(CCC(C(=O)NN3CCNCC3)CC2)c2ccccc21 |
| InChI | InChI=1S/C18H23N3O3/c22-16(20-21-11-9-19-10-12-21)13-5-7-18(8-6-13)15-4-2-1-3-14(15)17(23)24-18/h1-4,13,19H,5-12H2,(H,20,22) |
| InChIKey | GROKGHMAVKGFSQ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-oxo-N-piperazin-1-ylspiro[2-benzofuran-1,4'-cyclohexane]-1'-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxo-N-piperazin-1-ylspiro[2-benzofuran-1,4'-cyclohexane]-1'-carboxamide?
The IUPAC name of 3-oxo-N-piperazin-1-ylspiro[2-benzofuran-1,4'-cyclohexane]-1'-carboxamide (CID 67244640) is 3-oxo-N-piperazin-1-ylspiro[2-benzofuran-1,4'-cyclohexane]-1'-carboxamide.
What is the SMILES notation for 3-oxo-N-piperazin-1-ylspiro[2-benzofuran-1,4'-cyclohexane]-1'-carboxamide?
The canonical SMILES for 3-oxo-N-piperazin-1-ylspiro[2-benzofuran-1,4'-cyclohexane]-1'-carboxamide is O=C1OC2(CCC(C(=O)NN3CCNCC3)CC2)c2ccccc21.
What is the InChIKey of 3-oxo-N-piperazin-1-ylspiro[2-benzofuran-1,4'-cyclohexane]-1'-carboxamide?
The InChIKey is GROKGHMAVKGFSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N3O3/c22-16(20-21-11-9-19-10-12-21)13-5-7-18(8-6-13)15-4-2-1-3-14(15)17(23)24-18/h1-4,13,19H,5-12H2,(H,20,22).
What are the key properties of 3-oxo-N-piperazin-1-ylspiro[2-benzofuran-1,4'-cyclohexane]-1'-carboxamide?
3-oxo-N-piperazin-1-ylspiro[2-benzofuran-1,4'-cyclohexane]-1'-carboxamide has a molecular weight of 329.40 g/mol, XLogP of 1.18, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxo-N-piperazin-1-ylspiro[2-benzofuran-1,4'-cyclohexane]-1'-carboxamide is sourced from PubChem (CID 67244640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).