C19H21F5N2O3 — CID 6724472
(2S)-N-(cyclohexylmethyl)-3-hydroxy-2-[3-(2,3,4,5,6-pentafluorophenyl)prop-2-enoylamino]propanamide (PubChem CID 6724472) has the molecular formula C19H21F5N2O3 and a molecular weight of 420.38 g/mol. Its IUPAC name is (2S)-N-(cyclohexylmethyl)-3-hydroxy-2-[3-(2,3,4,5,6-pentafluorophenyl)prop-2-enoylamino]propanamide.
| Compound Name | (2S)-N-(cyclohexylmethyl)-3-hydroxy-2-[3-(2,3,4,5,6-pentafluorophenyl)prop-2-enoylamino]propanamide |
|---|---|
| PubChem CID | 6724472 |
| Molecular Formula | C19H21F5N2O3 |
| Molecular Weight | 420.38 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | (2S)-N-(cyclohexylmethyl)-3-hydroxy-2-[3-(2,3,4,5,6-pentafluorophenyl)prop-2-enoylamino]propanamide |
| SMILES | O=C(C=Cc1c(F)c(F)c(F)c(F)c1F)N[C@@H](CO)C(=O)NCC1CCCCC1 |
| InChI | InChI=1S/C19H21F5N2O3/c20-14-11(15(21)17(23)18(24)16(14)22)6-7-13(28)26-12(9-27)19(29)25-8-10-4-2-1-3-5-10/h6-7,10,12,27H,1-5,8-9H2,(H,25,29)(H,26,28)/t12-/m0/s1 |
| InChIKey | PXCJTOPIFYAMOU-LBPRGKRZSA-N |
| XLogP | 2.57 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|