C28H35F2NO5 — CID 67244911
(5R)-3-[6-(3,3-difluoro-3-phenylpropoxy)hexyl]-5-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-1,3-oxazolidin-2-one (PubChem CID 67244911) has the molecular formula C28H35F2NO5 and a molecular weight of 503.59 g/mol. Its IUPAC name is (5R)-3-[6-(3,3-difluoro-3-phenylpropoxy)hexyl]-5-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-1,3-oxazolidin-2-one.
| Compound Name | (5R)-3-[6-(3,3-difluoro-3-phenylpropoxy)hexyl]-5-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 67244911 |
| Molecular Formula | C28H35F2NO5 |
| Molecular Weight | 503.59 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | (5R)-3-[6-(3,3-difluoro-3-phenylpropoxy)hexyl]-5-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-1,3-oxazolidin-2-one |
| SMILES | CC1(C)OCc2cc([C@@H]3CN(CCCCCCOCCC(F)(F)c4ccccc4)C(=O)O3)ccc2O1 |
| InChI | InChI=1S/C28H35F2NO5/c1-27(2)34-20-22-18-21(12-13-24(22)36-27)25-19-31(26(32)35-25)15-8-3-4-9-16-33-17-14-28(29,30)23-10-6-5-7-11-23/h5-7,10-13,18,25H,3-4,8-9,14-17,19-20H2,1-2H3/t25-/m0/s1 |
| InChIKey | BFVDWIOWZDOLCL-VWLOTQADSA-N |
| XLogP | 6.58 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.59 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|