About methyl 7-[(1R,2R,5S)-2-chloro-5-[5-(1-hydroxyhexyl)thiophen-2-yl]cyclopentyl]heptanoate
methyl 7-[(1R,2R,5S)-2-chloro-5-[5-(1-hydroxyhexyl)thiophen-2-yl]cyclopentyl]heptanoate (PubChem CID 67245477) has the molecular formula C23H37ClO3S
and a molecular weight of 429.07 g/mol. Its IUPAC name is methyl 7-[(1R,2R,5S)-2-chloro-5-[5-(1-hydroxyhexyl)thiophen-2-yl]cyclopentyl]heptanoate.
Molecular Properties
| Compound Name | methyl 7-[(1R,2R,5S)-2-chloro-5-[5-(1-hydroxyhexyl)thiophen-2-yl]cyclopentyl]heptanoate |
| PubChem CID | 67245477 |
| Molecular Formula | C23H37ClO3S |
| Molecular Weight | 429.07 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | methyl 7-[(1R,2R,5S)-2-chloro-5-[5-(1-hydroxyhexyl)thiophen-2-yl]cyclopentyl]heptanoate |
| SMILES | CCCCCC(O)c1ccc([C@H]2CC[C@@H](Cl)[C@@H]2CCCCCCC(=O)OC)s1 |
| InChI | InChI=1S/C23H37ClO3S/c1-3-4-7-11-20(25)22-16-15-21(28-22)18-13-14-19(24)17(18)10-8-5-6-9-12-23(26)27-2/h15-20,25H,3-14H2,1-2H3/t17-,18+,19-,20?/m1/s1 |
| InChIKey | JOKHUGGYPJWGKH-BMHONFFRSA-N |
| XLogP | 6.98 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 429.07 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze methyl 7-[(1R,2R,5S)-2-chloro-5-[5-(1-hydroxyhexyl)thiophen-2-yl]cyclopentyl]heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-[(1R,2R,5S)-2-chloro-5-[5-(1-hydroxyhexyl)thiophen-2-yl]cyclopentyl]heptanoate?
The IUPAC name of methyl 7-[(1R,2R,5S)-2-chloro-5-[5-(1-hydroxyhexyl)thiophen-2-yl]cyclopentyl]heptanoate (CID 67245477) is methyl 7-[(1R,2R,5S)-2-chloro-5-[5-(1-hydroxyhexyl)thiophen-2-yl]cyclopentyl]heptanoate.
What is the SMILES notation for methyl 7-[(1R,2R,5S)-2-chloro-5-[5-(1-hydroxyhexyl)thiophen-2-yl]cyclopentyl]heptanoate?
The canonical SMILES for methyl 7-[(1R,2R,5S)-2-chloro-5-[5-(1-hydroxyhexyl)thiophen-2-yl]cyclopentyl]heptanoate is CCCCCC(O)c1ccc([C@H]2CC[C@@H](Cl)[C@@H]2CCCCCCC(=O)OC)s1.
What is the InChIKey of methyl 7-[(1R,2R,5S)-2-chloro-5-[5-(1-hydroxyhexyl)thiophen-2-yl]cyclopentyl]heptanoate?
The InChIKey is JOKHUGGYPJWGKH-BMHONFFRSA-N. The full InChI is InChI=1S/C23H37ClO3S/c1-3-4-7-11-20(25)22-16-15-21(28-22)18-13-14-19(24)17(18)10-8-5-6-9-12-23(26)27-2/h15-20,25H,3-14H2,1-2H3/t17-,18+,19-,20?/m1/s1.
What are the key properties of methyl 7-[(1R,2R,5S)-2-chloro-5-[5-(1-hydroxyhexyl)thiophen-2-yl]cyclopentyl]heptanoate?
methyl 7-[(1R,2R,5S)-2-chloro-5-[5-(1-hydroxyhexyl)thiophen-2-yl]cyclopentyl]heptanoate has a molecular weight of 429.07 g/mol, XLogP of 6.98, 13 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-[(1R,2R,5S)-2-chloro-5-[5-(1-hydroxyhexyl)thiophen-2-yl]cyclopentyl]heptanoate is sourced from PubChem (CID 67245477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).