About cinnoline-6-sulfinate
cinnoline-6-sulfinate (PubChem CID 67245906) has the molecular formula C8H5N2O2S-
and a molecular weight of 193.21 g/mol. Its IUPAC name is cinnoline-6-sulfinate.
Molecular Properties
| Compound Name | cinnoline-6-sulfinate |
| PubChem CID | 67245906 |
| Molecular Formula | C8H5N2O2S- |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.01 |
| IUPAC Name | cinnoline-6-sulfinate |
| SMILES | O=S([O-])c1ccc2nnccc2c1 |
| InChI | InChI=1S/C8H6N2O2S/c11-13(12)7-1-2-8-6(5-7)3-4-9-10-8/h1-5H,(H,11,12)/p-1 |
| InChIKey | RGZMVSDNTJPIAE-UHFFFAOYSA-M |
| XLogP | 0.87 |
| TPSA | 65.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze cinnoline-6-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cinnoline-6-sulfinate?
The IUPAC name of cinnoline-6-sulfinate (CID 67245906) is cinnoline-6-sulfinate.
What is the SMILES notation for cinnoline-6-sulfinate?
The canonical SMILES for cinnoline-6-sulfinate is O=S([O-])c1ccc2nnccc2c1.
What is the InChIKey of cinnoline-6-sulfinate?
The InChIKey is RGZMVSDNTJPIAE-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H6N2O2S/c11-13(12)7-1-2-8-6(5-7)3-4-9-10-8/h1-5H,(H,11,12)/p-1.
What are the key properties of cinnoline-6-sulfinate?
cinnoline-6-sulfinate has a molecular weight of 193.21 g/mol, XLogP of 0.87, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cinnoline-6-sulfinate is sourced from PubChem (CID 67245906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).