About acetamide;indol-2-one
acetamide;indol-2-one (PubChem CID 67245913) has the molecular formula C10H10N2O2
and a molecular weight of 190.20 g/mol. Its IUPAC name is acetamide;indol-2-one.
Molecular Properties
| Compound Name | acetamide;indol-2-one |
| PubChem CID | 67245913 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | acetamide;indol-2-one |
| SMILES | CC(N)=O.O=C1C=c2ccccc2=N1 |
| InChI | InChI=1S/C8H5NO.C2H5NO/c10-8-5-6-3-1-2-4-7(6)9-8;1-2(3)4/h1-5H;1H3,(H2,3,4) |
| InChIKey | AAJVRZILLDSYMG-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze acetamide;indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetamide;indol-2-one?
The IUPAC name of acetamide;indol-2-one (CID 67245913) is acetamide;indol-2-one.
What is the SMILES notation for acetamide;indol-2-one?
The canonical SMILES for acetamide;indol-2-one is CC(N)=O.O=C1C=c2ccccc2=N1.
What is the InChIKey of acetamide;indol-2-one?
The InChIKey is AAJVRZILLDSYMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO.C2H5NO/c10-8-5-6-3-1-2-4-7(6)9-8;1-2(3)4/h1-5H;1H3,(H2,3,4).
What are the key properties of acetamide;indol-2-one?
acetamide;indol-2-one has a molecular weight of 190.20 g/mol, XLogP of -0.88, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetamide;indol-2-one is sourced from PubChem (CID 67245913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).