About 2H-indazole-3-sulfinate
2H-indazole-3-sulfinate (PubChem CID 67246047) has the molecular formula C7H5N2O2S-
and a molecular weight of 181.20 g/mol. Its IUPAC name is 2H-indazole-3-sulfinate.
Molecular Properties
| Compound Name | 2H-indazole-3-sulfinate |
| PubChem CID | 67246047 |
| Molecular Formula | C7H5N2O2S- |
| Molecular Weight | 181.20 g/mol |
| Exact Mass | 181.01 |
| IUPAC Name | 2H-indazole-3-sulfinate |
| SMILES | O=S([O-])c1[nH]nc2ccccc12 |
| InChI | InChI=1S/C7H6N2O2S/c10-12(11)7-5-3-1-2-4-6(5)8-9-7/h1-4H,(H,8,9)(H,10,11)/p-1 |
| InChIKey | AGRZTRBTAMPPKK-UHFFFAOYSA-M |
| XLogP | 0.80 |
| TPSA | 68.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.20 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 2H-indazole-3-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-indazole-3-sulfinate?
The IUPAC name of 2H-indazole-3-sulfinate (CID 67246047) is 2H-indazole-3-sulfinate.
What is the SMILES notation for 2H-indazole-3-sulfinate?
The canonical SMILES for 2H-indazole-3-sulfinate is O=S([O-])c1[nH]nc2ccccc12.
What is the InChIKey of 2H-indazole-3-sulfinate?
The InChIKey is AGRZTRBTAMPPKK-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H6N2O2S/c10-12(11)7-5-3-1-2-4-6(5)8-9-7/h1-4H,(H,8,9)(H,10,11)/p-1.
What are the key properties of 2H-indazole-3-sulfinate?
2H-indazole-3-sulfinate has a molecular weight of 181.20 g/mol, XLogP of 0.80, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-indazole-3-sulfinate is sourced from PubChem (CID 67246047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).