About ethyl 2-[[3-[1,1-difluoro-2-(6-phenylmethoxyhexoxy)ethyl]phenyl]carbamoylamino]acetate
ethyl 2-[[3-[1,1-difluoro-2-(6-phenylmethoxyhexoxy)ethyl]phenyl]carbamoylamino]acetate (PubChem CID 67246087) has the molecular formula C26H34F2N2O5
and a molecular weight of 492.56 g/mol. Its IUPAC name is ethyl 2-[[3-[1,1-difluoro-2-(6-phenylmethoxyhexoxy)ethyl]phenyl]carbamoylamino]acetate.
Molecular Properties
| Compound Name | ethyl 2-[[3-[1,1-difluoro-2-(6-phenylmethoxyhexoxy)ethyl]phenyl]carbamoylamino]acetate |
| PubChem CID | 67246087 |
| Molecular Formula | C26H34F2N2O5 |
| Molecular Weight | 492.56 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | ethyl 2-[[3-[1,1-difluoro-2-(6-phenylmethoxyhexoxy)ethyl]phenyl]carbamoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)Nc1cccc(C(F)(F)COCCCCCCOCc2ccccc2)c1 |
| InChI | InChI=1S/C26H34F2N2O5/c1-2-35-24(31)18-29-25(32)30-23-14-10-13-22(17-23)26(27,28)20-34-16-9-4-3-8-15-33-19-21-11-6-5-7-12-21/h5-7,10-14,17H,2-4,8-9,15-16,18-20H2,1H3,(H2,29,30,32) |
| InChIKey | NCMKJFRRRRKVEX-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 492.56 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[[3-[1,1-difluoro-2-(6-phenylmethoxyhexoxy)ethyl]phenyl]carbamoylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[[3-[1,1-difluoro-2-(6-phenylmethoxyhexoxy)ethyl]phenyl]carbamoylamino]acetate?
The IUPAC name of ethyl 2-[[3-[1,1-difluoro-2-(6-phenylmethoxyhexoxy)ethyl]phenyl]carbamoylamino]acetate (CID 67246087) is ethyl 2-[[3-[1,1-difluoro-2-(6-phenylmethoxyhexoxy)ethyl]phenyl]carbamoylamino]acetate.
What is the SMILES notation for ethyl 2-[[3-[1,1-difluoro-2-(6-phenylmethoxyhexoxy)ethyl]phenyl]carbamoylamino]acetate?
The canonical SMILES for ethyl 2-[[3-[1,1-difluoro-2-(6-phenylmethoxyhexoxy)ethyl]phenyl]carbamoylamino]acetate is CCOC(=O)CNC(=O)Nc1cccc(C(F)(F)COCCCCCCOCc2ccccc2)c1.
What is the InChIKey of ethyl 2-[[3-[1,1-difluoro-2-(6-phenylmethoxyhexoxy)ethyl]phenyl]carbamoylamino]acetate?
The InChIKey is NCMKJFRRRRKVEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H34F2N2O5/c1-2-35-24(31)18-29-25(32)30-23-14-10-13-22(17-23)26(27,28)20-34-16-9-4-3-8-15-33-19-21-11-6-5-7-12-21/h5-7,10-14,17H,2-4,8-9,15-16,18-20H2,1H3,(H2,29,30,32).
What are the key properties of ethyl 2-[[3-[1,1-difluoro-2-(6-phenylmethoxyhexoxy)ethyl]phenyl]carbamoylamino]acetate?
ethyl 2-[[3-[1,1-difluoro-2-(6-phenylmethoxyhexoxy)ethyl]phenyl]carbamoylamino]acetate has a molecular weight of 492.56 g/mol, XLogP of 5.26, 16 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[[3-[1,1-difluoro-2-(6-phenylmethoxyhexoxy)ethyl]phenyl]carbamoylamino]acetate is sourced from PubChem (CID 67246087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).