C19H21F2N5O2 — CID 67246185
2-amino-8-cyclopentyl-6-(5,6-difluoro-6-methoxy-1H-pyridin-3-yl)-4-methylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 67246185) has the molecular formula C19H21F2N5O2 and a molecular weight of 389.41 g/mol. Its IUPAC name is 2-amino-8-cyclopentyl-6-(5,6-difluoro-6-methoxy-1H-pyridin-3-yl)-4-methylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-amino-8-cyclopentyl-6-(5,6-difluoro-6-methoxy-1H-pyridin-3-yl)-4-methylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 67246185 |
| Molecular Formula | C19H21F2N5O2 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 2-amino-8-cyclopentyl-6-(5,6-difluoro-6-methoxy-1H-pyridin-3-yl)-4-methylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | COC1(F)NC=C(c2cc3c(C)nc(N)nc3n(C3CCCC3)c2=O)C=C1F |
| InChI | InChI=1S/C19H21F2N5O2/c1-10-13-8-14(11-7-15(20)19(21,28-2)23-9-11)17(27)26(12-5-3-4-6-12)16(13)25-18(22)24-10/h7-9,12,23H,3-6H2,1-2H3,(H2,22,24,25) |
| InChIKey | MFOOUBYEJPITGY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|