cinnoline-4-sulfinic acid

C8H6N2O2S — CID 67246299

IUPACcinnoline-4-sulfinic acid
SMILESO=S(O)c1cnnc2ccccc12
InChIInChI=1S/C8H6N2O2S/c11-13(12)8-5-9-10-7-4-2-1-3-6(7)8/h1-5H,(H,11,12)
InChIKeyNNJYMTRBFJQNGM-UHFFFAOYSA-N
MW194.22 g/mol
LogP1.21
Rot. Bonds1

About cinnoline-4-sulfinic acid

cinnoline-4-sulfinic acid (PubChem CID 67246299) has the molecular formula C8H6N2O2S and a molecular weight of 194.22 g/mol. Its IUPAC name is cinnoline-4-sulfinic acid.

Molecular Properties

Compound Namecinnoline-4-sulfinic acid
PubChem CID67246299
Molecular FormulaC8H6N2O2S
Molecular Weight194.22 g/mol
Exact Mass194.01
IUPAC Namecinnoline-4-sulfinic acid
SMILESO=S(O)c1cnnc2ccccc12
InChIInChI=1S/C8H6N2O2S/c11-13(12)8-5-9-10-7-4-2-1-3-6(7)8/h1-5H,(H,11,12)
InChIKeyNNJYMTRBFJQNGM-UHFFFAOYSA-N
XLogP1.21
TPSA63.08 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500194.22
LogP ≤ 51.21
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}

Analyze cinnoline-4-sulfinic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cinnoline-4-sulfinic acid?
The IUPAC name of cinnoline-4-sulfinic acid (CID 67246299) is cinnoline-4-sulfinic acid.
What is the SMILES notation for cinnoline-4-sulfinic acid?
The canonical SMILES for cinnoline-4-sulfinic acid is O=S(O)c1cnnc2ccccc12.
What is the InChIKey of cinnoline-4-sulfinic acid?
The InChIKey is NNJYMTRBFJQNGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O2S/c11-13(12)8-5-9-10-7-4-2-1-3-6(7)8/h1-5H,(H,11,12).
What are the key properties of cinnoline-4-sulfinic acid?
cinnoline-4-sulfinic acid has a molecular weight of 194.22 g/mol, XLogP of 1.21, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cinnoline-4-sulfinic acid is sourced from PubChem (CID 67246299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).