About 6-methylfuro[3,2-b]pyridine-5-carbonitrile
6-methylfuro[3,2-b]pyridine-5-carbonitrile (PubChem CID 67246676) has the molecular formula C9H6N2O
and a molecular weight of 158.16 g/mol. Its IUPAC name is 6-methylfuro[3,2-b]pyridine-5-carbonitrile.
Molecular Properties
| Compound Name | 6-methylfuro[3,2-b]pyridine-5-carbonitrile |
| PubChem CID | 67246676 |
| Molecular Formula | C9H6N2O |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | 6-methylfuro[3,2-b]pyridine-5-carbonitrile |
| SMILES | Cc1cc2occc2nc1C#N |
| InChI | InChI=1S/C9H6N2O/c1-6-4-9-7(2-3-12-9)11-8(6)5-10/h2-4H,1H3 |
| InChIKey | AEAMIHCEHMEESR-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-methylfuro[3,2-b]pyridine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylfuro[3,2-b]pyridine-5-carbonitrile?
The IUPAC name of 6-methylfuro[3,2-b]pyridine-5-carbonitrile (CID 67246676) is 6-methylfuro[3,2-b]pyridine-5-carbonitrile.
What is the SMILES notation for 6-methylfuro[3,2-b]pyridine-5-carbonitrile?
The canonical SMILES for 6-methylfuro[3,2-b]pyridine-5-carbonitrile is Cc1cc2occc2nc1C#N.
What is the InChIKey of 6-methylfuro[3,2-b]pyridine-5-carbonitrile?
The InChIKey is AEAMIHCEHMEESR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O/c1-6-4-9-7(2-3-12-9)11-8(6)5-10/h2-4H,1H3.
What are the key properties of 6-methylfuro[3,2-b]pyridine-5-carbonitrile?
6-methylfuro[3,2-b]pyridine-5-carbonitrile has a molecular weight of 158.16 g/mol, XLogP of 2.01, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylfuro[3,2-b]pyridine-5-carbonitrile is sourced from PubChem (CID 67246676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).