C26H41NO — CID 67246891
(8R,9S,10S,13S,14S)-10,13-dimethyl-17-(1-piperidin-1-ylethyl)-1,2,4,5,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 67246891) has the molecular formula C26H41NO and a molecular weight of 383.62 g/mol. Its IUPAC name is (8R,9S,10S,13S,14S)-10,13-dimethyl-17-(1-piperidin-1-ylethyl)-1,2,4,5,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9S,10S,13S,14S)-10,13-dimethyl-17-(1-piperidin-1-ylethyl)-1,2,4,5,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 67246891 |
| Molecular Formula | C26H41NO |
| Molecular Weight | 383.62 g/mol |
| Exact Mass | 383.32 |
| IUPAC Name | (8R,9S,10S,13S,14S)-10,13-dimethyl-17-(1-piperidin-1-ylethyl)-1,2,4,5,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC(C1=CC[C@H]2[C@@H]3CCC4CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C)N1CCCCC1 |
| InChI | InChI=1S/C26H41NO/c1-18(27-15-5-4-6-16-27)22-9-10-23-21-8-7-19-17-20(28)11-13-25(19,2)24(21)12-14-26(22,23)3/h9,18-19,21,23-24H,4-8,10-17H2,1-3H3/t18?,19?,21-,23-,24-,25-,26+/m0/s1 |
| InChIKey | HRTKLLCMRIXWLP-KUISYXJUSA-N |
| XLogP | 6.01 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.62 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|