C25H37NO — CID 67247129
(8R,9S,10R,13S,14S)-7,10,13-trimethyl-17-piperidin-1-yl-1,2,4,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 67247129) has the molecular formula C25H37NO and a molecular weight of 367.58 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-7,10,13-trimethyl-17-piperidin-1-yl-1,2,4,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9S,10R,13S,14S)-7,10,13-trimethyl-17-piperidin-1-yl-1,2,4,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 67247129 |
| Molecular Formula | C25H37NO |
| Molecular Weight | 367.58 g/mol |
| Exact Mass | 367.29 |
| IUPAC Name | (8R,9S,10R,13S,14S)-7,10,13-trimethyl-17-piperidin-1-yl-1,2,4,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC1C=C2CC(=O)CC[C@]2(C)[C@H]2CC[C@]3(C)C(N4CCCCC4)=CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C25H37NO/c1-17-15-18-16-19(27)9-11-24(18,2)21-10-12-25(3)20(23(17)21)7-8-22(25)26-13-5-4-6-14-26/h8,15,17,20-21,23H,4-7,9-14,16H2,1-3H3/t17?,20-,21-,23-,24-,25-/m0/s1 |
| InChIKey | QEBNIWOYSHCAQO-WIJIPUKXSA-N |
| XLogP | 5.74 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.58 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|