C29H44N4O2 — CID 67247220
(2S,3R)-2-amino-6-[4-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperazin-1-yl]hexane-1,3-diol (PubChem CID 67247220) has the molecular formula C29H44N4O2 and a molecular weight of 480.70 g/mol. Its IUPAC name is (2S,3R)-2-amino-6-[4-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperazin-1-yl]hexane-1,3-diol.
| Compound Name | (2S,3R)-2-amino-6-[4-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperazin-1-yl]hexane-1,3-diol |
|---|---|
| PubChem CID | 67247220 |
| Molecular Formula | C29H44N4O2 |
| Molecular Weight | 480.70 g/mol |
| Exact Mass | 480.35 |
| IUPAC Name | (2S,3R)-2-amino-6-[4-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperazin-1-yl]hexane-1,3-diol |
| SMILES | CC1(C)CCC(C)(C)c2cc(-c3cccc(N4CCN(CCC[C@@H](O)[C@@H](N)CO)CC4)n3)ccc21 |
| InChI | InChI=1S/C29H44N4O2/c1-28(2)12-13-29(3,4)23-19-21(10-11-22(23)28)25-7-5-9-27(31-25)33-17-15-32(16-18-33)14-6-8-26(35)24(30)20-34/h5,7,9-11,19,24,26,34-35H,6,8,12-18,20,30H2,1-4H3/t24-,26+/m0/s1 |
| InChIKey | VLGWAKLIYDXIGA-AZGAKELHSA-N |
| XLogP | 3.68 |
| TPSA | 85.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.70 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |