C28H41N3O2 — CID 67247227
2-[4-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperazin-1-yl]pentane-1,5-diol (PubChem CID 67247227) has the molecular formula C28H41N3O2 and a molecular weight of 451.66 g/mol. Its IUPAC name is 2-[4-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperazin-1-yl]pentane-1,5-diol.
| Compound Name | 2-[4-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperazin-1-yl]pentane-1,5-diol |
|---|---|
| PubChem CID | 67247227 |
| Molecular Formula | C28H41N3O2 |
| Molecular Weight | 451.66 g/mol |
| Exact Mass | 451.32 |
| IUPAC Name | 2-[4-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperazin-1-yl]pentane-1,5-diol |
| SMILES | CC1(C)CCC(C)(C)c2cc(-c3cccc(N4CCN(C(CO)CCCO)CC4)n3)ccc21 |
| InChI | InChI=1S/C28H41N3O2/c1-27(2)12-13-28(3,4)24-19-21(10-11-23(24)27)25-8-5-9-26(29-25)31-16-14-30(15-17-31)22(20-33)7-6-18-32/h5,8-11,19,22,32-33H,6-7,12-18,20H2,1-4H3 |
| InChIKey | PSCNWGOFLMSACB-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 59.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.66 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |