C14H20N4O4 — CID 6724742
(2S)-3-hydroxy-N-morpholin-4-yl-2-[(2-pyridin-4-ylacetyl)amino]propanamide (PubChem CID 6724742) has the molecular formula C14H20N4O4 and a molecular weight of 308.34 g/mol. Its IUPAC name is (2S)-3-hydroxy-N-morpholin-4-yl-2-[(2-pyridin-4-ylacetyl)amino]propanamide.
| Compound Name | (2S)-3-hydroxy-N-morpholin-4-yl-2-[(2-pyridin-4-ylacetyl)amino]propanamide |
|---|---|
| PubChem CID | 6724742 |
| Molecular Formula | C14H20N4O4 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | (2S)-3-hydroxy-N-morpholin-4-yl-2-[(2-pyridin-4-ylacetyl)amino]propanamide |
| SMILES | O=C(Cc1ccncc1)N[C@@H](CO)C(=O)NN1CCOCC1 |
| InChI | InChI=1S/C14H20N4O4/c19-10-12(14(21)17-18-5-7-22-8-6-18)16-13(20)9-11-1-3-15-4-2-11/h1-4,12,19H,5-10H2,(H,16,20)(H,17,21)/t12-/m0/s1 |
| InChIKey | WFMBKHRVNUKFQV-LBPRGKRZSA-N |
| XLogP | -1.54 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |