About [2,5-dichloro-1-[(4-chlorophenyl)methyl]indol-3-yl]-(2-phenyl-1,3-oxazol-5-yl)methanone
[2,5-dichloro-1-[(4-chlorophenyl)methyl]indol-3-yl]-(2-phenyl-1,3-oxazol-5-yl)methanone (PubChem CID 67247506) has the molecular formula C25H15Cl3N2O2
and a molecular weight of 481.77 g/mol. Its IUPAC name is [2,5-dichloro-1-[(4-chlorophenyl)methyl]indol-3-yl]-(2-phenyl-1,3-oxazol-5-yl)methanone.
Molecular Properties
| Compound Name | [2,5-dichloro-1-[(4-chlorophenyl)methyl]indol-3-yl]-(2-phenyl-1,3-oxazol-5-yl)methanone |
| PubChem CID | 67247506 |
| Molecular Formula | C25H15Cl3N2O2 |
| Molecular Weight | 481.77 g/mol |
| Exact Mass | 480.02 |
| IUPAC Name | [2,5-dichloro-1-[(4-chlorophenyl)methyl]indol-3-yl]-(2-phenyl-1,3-oxazol-5-yl)methanone |
| SMILES | O=C(c1cnc(-c2ccccc2)o1)c1c(Cl)n(Cc2ccc(Cl)cc2)c2ccc(Cl)cc12 |
| InChI | InChI=1S/C25H15Cl3N2O2/c26-17-8-6-15(7-9-17)14-30-20-11-10-18(27)12-19(20)22(24(30)28)23(31)21-13-29-25(32-21)16-4-2-1-3-5-16/h1-13H,14H2 |
| InChIKey | BQVKSNGFHRTMDN-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 481.77 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2,5-dichloro-1-[(4-chlorophenyl)methyl]indol-3-yl]-(2-phenyl-1,3-oxazol-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,5-dichloro-1-[(4-chlorophenyl)methyl]indol-3-yl]-(2-phenyl-1,3-oxazol-5-yl)methanone?
The IUPAC name of [2,5-dichloro-1-[(4-chlorophenyl)methyl]indol-3-yl]-(2-phenyl-1,3-oxazol-5-yl)methanone (CID 67247506) is [2,5-dichloro-1-[(4-chlorophenyl)methyl]indol-3-yl]-(2-phenyl-1,3-oxazol-5-yl)methanone.
What is the SMILES notation for [2,5-dichloro-1-[(4-chlorophenyl)methyl]indol-3-yl]-(2-phenyl-1,3-oxazol-5-yl)methanone?
The canonical SMILES for [2,5-dichloro-1-[(4-chlorophenyl)methyl]indol-3-yl]-(2-phenyl-1,3-oxazol-5-yl)methanone is O=C(c1cnc(-c2ccccc2)o1)c1c(Cl)n(Cc2ccc(Cl)cc2)c2ccc(Cl)cc12.
What is the InChIKey of [2,5-dichloro-1-[(4-chlorophenyl)methyl]indol-3-yl]-(2-phenyl-1,3-oxazol-5-yl)methanone?
The InChIKey is BQVKSNGFHRTMDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H15Cl3N2O2/c26-17-8-6-15(7-9-17)14-30-20-11-10-18(27)12-19(20)22(24(30)28)23(31)21-13-29-25(32-21)16-4-2-1-3-5-16/h1-13H,14H2.
What are the key properties of [2,5-dichloro-1-[(4-chlorophenyl)methyl]indol-3-yl]-(2-phenyl-1,3-oxazol-5-yl)methanone?
[2,5-dichloro-1-[(4-chlorophenyl)methyl]indol-3-yl]-(2-phenyl-1,3-oxazol-5-yl)methanone has a molecular weight of 481.77 g/mol, XLogP of 7.54, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2,5-dichloro-1-[(4-chlorophenyl)methyl]indol-3-yl]-(2-phenyl-1,3-oxazol-5-yl)methanone is sourced from PubChem (CID 67247506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).