C24H23N5O4S — CID 67248027
8-(benzenesulfonyl)-3-[1-(2-hydroxyethyl)piperidin-4-yl]oxy-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile (PubChem CID 67248027) has the molecular formula C24H23N5O4S and a molecular weight of 477.55 g/mol. Its IUPAC name is 8-(benzenesulfonyl)-3-[1-(2-hydroxyethyl)piperidin-4-yl]oxy-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile.
| Compound Name | 8-(benzenesulfonyl)-3-[1-(2-hydroxyethyl)piperidin-4-yl]oxy-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile |
|---|---|
| PubChem CID | 67248027 |
| Molecular Formula | C24H23N5O4S |
| Molecular Weight | 477.55 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 8-(benzenesulfonyl)-3-[1-(2-hydroxyethyl)piperidin-4-yl]oxy-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carbonitrile |
| SMILES | N#Cc1ncc2c(c1OC1CCN(CCO)CC1)c1cccnc1n2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H23N5O4S/c25-15-20-23(33-17-8-11-28(12-9-17)13-14-30)22-19-7-4-10-26-24(19)29(21(22)16-27-20)34(31,32)18-5-2-1-3-6-18/h1-7,10,16-17,30H,8-9,11-14H2 |
| InChIKey | TXUXJNVJBBIQLF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 121.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.55 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |